611-99-4
| Name | 4,4'-Dihydroxybenzophenone |
| CAS | 611-99-4 |
| EINECS(EC#) | 210-288-1 |
| Molecular Formula | C13H10O3 |
| MDL Number | MFCD00002358 |
| Molecular Weight | 214.22 |
| MOL File | 611-99-4.mol |
Chemical Properties
| Appearance | off-white to beige fine crystalline powder |
| Melting point | 213-215 °C(lit.) |
| Boiling point | 314.35°C (rough estimate) |
| density | 1.1330 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| pka | 7.67±0.15(Predicted) |
| color | Off-white to beige |
| Water Solubility | insoluble |
| BRN | 1874572 |
| InChI | 1S/C13H10O3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,14-15H |
| InChIKey | RXNYJUSEXLAVNQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)c2ccc(O)cc2 |
| LogP | 2.5 |
| CAS DataBase Reference | 611-99-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(4-hydroxyphenyl)methanone(611-99-4) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DJ0880000 |
| TSCA | TSCA listed |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |